C19H21ClFNO2 — CID 18552686
4-(4-chlorophenyl)-1-[2-(4-fluorophenyl)-2-hydroxyethyl]piperidin-4-ol (PubChem CID 18552686) has the molecular formula C19H21ClFNO2 and a molecular weight of 349.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[2-(4-fluorophenyl)-2-hydroxyethyl]piperidin-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-[2-(4-fluorophenyl)-2-hydroxyethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 18552686 |
| Molecular Formula | C19H21ClFNO2 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[2-(4-fluorophenyl)-2-hydroxyethyl]piperidin-4-ol |
| SMILES | OC(CN1CCC(O)(c2ccc(Cl)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21ClFNO2/c20-16-5-3-15(4-6-16)19(24)9-11-22(12-10-19)13-18(23)14-1-7-17(21)8-2-14/h1-8,18,23-24H,9-13H2 |
| InChIKey | LREGUFUHRANVMZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |