C25H26FNO2 — CID 51501336
4-(4-fluorophenyl)-1-[(2S)-2-hydroxy-2-(4-phenylphenyl)ethyl]piperidin-4-ol (PubChem CID 51501336) has the molecular formula C25H26FNO2 and a molecular weight of 391.49 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[(2S)-2-hydroxy-2-(4-phenylphenyl)ethyl]piperidin-4-ol.
| Compound Name | 4-(4-fluorophenyl)-1-[(2S)-2-hydroxy-2-(4-phenylphenyl)ethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 51501336 |
| Molecular Formula | C25H26FNO2 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[(2S)-2-hydroxy-2-(4-phenylphenyl)ethyl]piperidin-4-ol |
| SMILES | O[C@H](CN1CCC(O)(c2ccc(F)cc2)CC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26FNO2/c26-23-12-10-22(11-13-23)25(29)14-16-27(17-15-25)18-24(28)21-8-6-20(7-9-21)19-4-2-1-3-5-19/h1-13,24,28-29H,14-18H2/t24-/m1/s1 |
| InChIKey | JFZDDZLIKOZMOM-XMMPIXPASA-N |
| XLogP | 4.51 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |