C20H21ClF3NO2 — CID 51501534
1-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol (PubChem CID 51501534) has the molecular formula C20H21ClF3NO2 and a molecular weight of 399.84 g/mol. Its IUPAC name is 1-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol.
| Compound Name | 1-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 51501534 |
| Molecular Formula | C20H21ClF3NO2 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
| SMILES | O[C@@H](CN1CCC(O)(c2cccc(C(F)(F)F)c2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClF3NO2/c21-17-6-4-14(5-7-17)18(26)13-25-10-8-19(27,9-11-25)15-2-1-3-16(12-15)20(22,23)24/h1-7,12,18,26-27H,8-11,13H2/t18-/m0/s1 |
| InChIKey | WTWJMEWIEGPURL-SFHVURJKSA-N |
| XLogP | 4.38 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |