C13H17F3INO — CID 171929292
1-methyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol;hydroiodide (PubChem CID 171929292) has the molecular formula C13H17F3INO and a molecular weight of 387.18 g/mol. Its IUPAC name is 1-methyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol;hydroiodide.
| Compound Name | 1-methyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol;hydroiodide |
|---|---|
| PubChem CID | 171929292 |
| Molecular Formula | C13H17F3INO |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 1-methyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol;hydroiodide |
| SMILES | CN1CCC(O)(c2cccc(C(F)(F)F)c2)CC1.I |
| InChI | InChI=1S/C13H16F3NO.HI/c1-17-7-5-12(18,6-8-17)10-3-2-4-11(9-10)13(14,15)16;/h2-4,9,18H,5-8H2,1H3;1H |
| InChIKey | FSUOAMNBRCSWNS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|