C21H22F3N3O — CID 24815354
1-[(1-methylbenzimidazol-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol (PubChem CID 24815354) has the molecular formula C21H22F3N3O and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-[(1-methylbenzimidazol-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol.
| Compound Name | 1-[(1-methylbenzimidazol-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 24815354 |
| Molecular Formula | C21H22F3N3O |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[(1-methylbenzimidazol-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
| SMILES | Cn1c(CN2CCC(O)(c3cccc(C(F)(F)F)c3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C21H22F3N3O/c1-26-18-8-3-2-7-17(18)25-19(26)14-27-11-9-20(28,10-12-27)15-5-4-6-16(13-15)21(22,23)24/h2-8,13,28H,9-12,14H2,1H3 |
| InChIKey | KOCCNBWBXWOOFM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |