C22H27F3N4OS — CID 167443695
ethanol;2-[4-[(1-methylbenzimidazol-2-yl)methyl]piperazin-1-yl]-4-(trifluoromethyl)benzenethiol (PubChem CID 167443695) has the molecular formula C22H27F3N4OS and a molecular weight of 452.55 g/mol. Its IUPAC name is ethanol;2-[4-[(1-methylbenzimidazol-2-yl)methyl]piperazin-1-yl]-4-(trifluoromethyl)benzenethiol.
| Compound Name | ethanol;2-[4-[(1-methylbenzimidazol-2-yl)methyl]piperazin-1-yl]-4-(trifluoromethyl)benzenethiol |
|---|---|
| PubChem CID | 167443695 |
| Molecular Formula | C22H27F3N4OS |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | ethanol;2-[4-[(1-methylbenzimidazol-2-yl)methyl]piperazin-1-yl]-4-(trifluoromethyl)benzenethiol |
| SMILES | CCO.Cn1c(CN2CCN(c3cc(C(F)(F)F)ccc3S)CC2)nc2ccccc21 |
| InChI | InChI=1S/C20H21F3N4S.C2H6O/c1-25-16-5-3-2-4-15(16)24-19(25)13-26-8-10-27(11-9-26)17-12-14(20(21,22)23)6-7-18(17)28;1-2-3/h2-7,12,28H,8-11,13H2,1H3;3H,2H2,1H3 |
| InChIKey | BHXZAIFHZGVYNT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|