C18H17F3N2O3 — CID 72885433
6-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]pyridine-2-carboxylic acid (PubChem CID 72885433) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is 6-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]pyridine-2-carboxylic acid.
| Compound Name | 6-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 72885433 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 6-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(N2CCC(O)(c3cccc(C(F)(F)F)c3)CC2)n1 |
| InChI | InChI=1S/C18H17F3N2O3/c19-18(20,21)13-4-1-3-12(11-13)17(26)7-9-23(10-8-17)15-6-2-5-14(22-15)16(24)25/h1-6,11,26H,7-10H2,(H,24,25) |
| InChIKey | WBYRUPWVSRUQHZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |