C17H17F3N2O2 — CID 56904857
[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-(1H-pyrrol-3-yl)methanone (PubChem CID 56904857) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is [4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-(1H-pyrrol-3-yl)methanone.
| Compound Name | [4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-(1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 56904857 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-(1H-pyrrol-3-yl)methanone |
| SMILES | O=C(c1cc[nH]c1)N1CCC(O)(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H17F3N2O2/c18-17(19,20)14-3-1-2-13(10-14)16(24)5-8-22(9-6-16)15(23)12-4-7-21-11-12/h1-4,7,10-11,21,24H,5-6,8-9H2 |
| InChIKey | FJUWDCSVCGQSNK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |