C24H22F3N3O2 — CID 44755671
(4-hydroxy-4-phenylpiperidin-1-yl)-[6-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone (PubChem CID 44755671) has the molecular formula C24H22F3N3O2 and a molecular weight of 441.45 g/mol. Its IUPAC name is (4-hydroxy-4-phenylpiperidin-1-yl)-[6-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone.
| Compound Name | (4-hydroxy-4-phenylpiperidin-1-yl)-[6-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 44755671 |
| Molecular Formula | C24H22F3N3O2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (4-hydroxy-4-phenylpiperidin-1-yl)-[6-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(Nc2cccc(C(F)(F)F)c2)nc1)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H22F3N3O2/c25-24(26,27)19-7-4-8-20(15-19)29-21-10-9-17(16-28-21)22(31)30-13-11-23(32,12-14-30)18-5-2-1-3-6-18/h1-10,15-16,32H,11-14H2,(H,28,29) |
| InChIKey | VWLOBIJFZGTZFG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |