C16H28ClNO — CID 144802355
4-(3-chlorophenyl)-1-methylpiperidin-4-ol;ethane (PubChem CID 144802355) has the molecular formula C16H28ClNO and a molecular weight of 285.86 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-1-methylpiperidin-4-ol;ethane.
| Compound Name | 4-(3-chlorophenyl)-1-methylpiperidin-4-ol;ethane |
|---|---|
| PubChem CID | 144802355 |
| Molecular Formula | C16H28ClNO |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 4-(3-chlorophenyl)-1-methylpiperidin-4-ol;ethane |
| SMILES | CC.CC.CN1CCC(O)(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C12H16ClNO.2C2H6/c1-14-7-5-12(15,6-8-14)10-3-2-4-11(13)9-10;2*1-2/h2-4,9,15H,5-8H2,1H3;2*1-2H3 |
| InChIKey | GWFWHMHDDICFQW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |