About 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol
4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol (PubChem CID 170108590) has the molecular formula C13H18ClNO
and a molecular weight of 239.75 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol |
| PubChem CID | 170108590 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol |
| SMILES | CC1CC(O)(c2cccc(Cl)c2)CC(C)N1 |
| InChI | InChI=1S/C13H18ClNO/c1-9-7-13(16,8-10(2)15-9)11-4-3-5-12(14)6-11/h3-6,9-10,15-16H,7-8H2,1-2H3 |
| InChIKey | HDWPXIYUSOQKTC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol?
The IUPAC name of 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol (CID 170108590) is 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol.
What is the SMILES notation for 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol?
The canonical SMILES for 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol is CC1CC(O)(c2cccc(Cl)c2)CC(C)N1.
What is the InChIKey of 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol?
The InChIKey is HDWPXIYUSOQKTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO/c1-9-7-13(16,8-10(2)15-9)11-4-3-5-12(14)6-11/h3-6,9-10,15-16H,7-8H2,1-2H3.
What are the key properties of 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol?
4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol has a molecular weight of 239.75 g/mol, XLogP of 2.69, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenyl)-2,6-dimethylpiperidin-4-ol is sourced from PubChem (CID 170108590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).