C12H13ClO2 — CID 66432381
1-(3-chlorophenyl)-2-methylcyclobutane-1-carboxylic acid (PubChem CID 66432381) has the molecular formula C12H13ClO2 and a molecular weight of 224.69 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-methylcyclobutane-1-carboxylic acid.
| Compound Name | 1-(3-chlorophenyl)-2-methylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 66432381 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-(3-chlorophenyl)-2-methylcyclobutane-1-carboxylic acid |
| SMILES | CC1CCC1(C(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClO2/c1-8-5-6-12(8,11(14)15)9-3-2-4-10(13)7-9/h2-4,7-8H,5-6H2,1H3,(H,14,15) |
| InChIKey | WWLIDUDKRVXNKV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |