C25H30Cl2N2O — CID 151582814
bis[2-amino-1-(3-chlorophenyl)cyclohexyl]methanone (PubChem CID 151582814) has the molecular formula C25H30Cl2N2O and a molecular weight of 445.43 g/mol. Its IUPAC name is bis[2-amino-1-(3-chlorophenyl)cyclohexyl]methanone.
| Compound Name | bis[2-amino-1-(3-chlorophenyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 151582814 |
| Molecular Formula | C25H30Cl2N2O |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | bis[2-amino-1-(3-chlorophenyl)cyclohexyl]methanone |
| SMILES | NC1CCCCC1(C(=O)C1(c2cccc(Cl)c2)CCCCC1N)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H30Cl2N2O/c26-19-9-5-7-17(15-19)24(13-3-1-11-21(24)28)23(30)25(14-4-2-12-22(25)29)18-8-6-10-20(27)16-18/h5-10,15-16,21-22H,1-4,11-14,28-29H2 |
| InChIKey | QGVWXSUDMYLHDW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |