C18H26ClN — CID 63408511
1-(3-chlorophenyl)-2-cyclohexylcyclohexan-1-amine (PubChem CID 63408511) has the molecular formula C18H26ClN and a molecular weight of 291.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-cyclohexylcyclohexan-1-amine.
| Compound Name | 1-(3-chlorophenyl)-2-cyclohexylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63408511 |
| Molecular Formula | C18H26ClN |
| Molecular Weight | 291.87 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-(3-chlorophenyl)-2-cyclohexylcyclohexan-1-amine |
| SMILES | NC1(c2cccc(Cl)c2)CCCCC1C1CCCCC1 |
| InChI | InChI=1S/C18H26ClN/c19-16-10-6-9-15(13-16)18(20)12-5-4-11-17(18)14-7-2-1-3-8-14/h6,9-10,13-14,17H,1-5,7-8,11-12,20H2 |
| InChIKey | KNCIJDDNHODYMX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.87 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |