C18H25Cl2N — CID 63408171
2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine (PubChem CID 63408171) has the molecular formula C18H25Cl2N and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine.
| Compound Name | 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 63408171 |
| Molecular Formula | C18H25Cl2N |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine |
| SMILES | NC1(c2ccc(Cl)c(Cl)c2)CCCCC1C1CCCCC1 |
| InChI | InChI=1S/C18H25Cl2N/c19-16-10-9-14(12-17(16)20)18(21)11-5-4-8-15(18)13-6-2-1-3-7-13/h9-10,12-13,15H,1-8,11,21H2 |
| InChIKey | KEMJBCRZAXHVME-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |