About 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine
2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine (PubChem CID 63408171) has the molecular formula C18H25Cl2N
and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine |
| PubChem CID | 63408171 |
| Molecular Formula | C18H25Cl2N |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine |
| SMILES | NC1(c2ccc(Cl)c(Cl)c2)CCCCC1C1CCCCC1 |
| InChI | InChI=1S/C18H25Cl2N/c19-16-10-9-14(12-17(16)20)18(21)11-5-4-8-15(18)13-6-2-1-3-7-13/h9-10,12-13,15H,1-8,11,21H2 |
| InChIKey | KEMJBCRZAXHVME-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine?
The IUPAC name of 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine (CID 63408171) is 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine.
What is the SMILES notation for 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine?
The canonical SMILES for 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine is NC1(c2ccc(Cl)c(Cl)c2)CCCCC1C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine?
The InChIKey is KEMJBCRZAXHVME-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25Cl2N/c19-16-10-9-14(12-17(16)20)18(21)11-5-4-8-15(18)13-6-2-1-3-7-13/h9-10,12-13,15H,1-8,11,21H2.
What are the key properties of 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine?
2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine has a molecular weight of 326.31 g/mol, XLogP of 5.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1-(3,4-dichlorophenyl)cyclohexan-1-amine is sourced from PubChem (CID 63408171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).