C17H15ClO2 — CID 65016810
1-(3-chlorophenyl)-3-phenylcyclobutane-1-carboxylic acid (PubChem CID 65016810) has the molecular formula C17H15ClO2 and a molecular weight of 286.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-phenylcyclobutane-1-carboxylic acid.
| Compound Name | 1-(3-chlorophenyl)-3-phenylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 65016810 |
| Molecular Formula | C17H15ClO2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-(3-chlorophenyl)-3-phenylcyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cccc(Cl)c2)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C17H15ClO2/c18-15-8-4-7-14(9-15)17(16(19)20)10-13(11-17)12-5-2-1-3-6-12/h1-9,13H,10-11H2,(H,19,20) |
| InChIKey | CRNFSKVOOHOFPH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |