C14H19FO — CID 64735546
1-(3-fluorophenyl)-3,5-dimethylcyclohexan-1-ol (PubChem CID 64735546) has the molecular formula C14H19FO and a molecular weight of 222.30 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3,5-dimethylcyclohexan-1-ol.
| Compound Name | 1-(3-fluorophenyl)-3,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 64735546 |
| Molecular Formula | C14H19FO |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-(3-fluorophenyl)-3,5-dimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)CC(O)(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C14H19FO/c1-10-6-11(2)9-14(16,8-10)12-4-3-5-13(15)7-12/h3-5,7,10-11,16H,6,8-9H2,1-2H3 |
| InChIKey | RWTFYNNQHIEYIB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |