C18H28O — CID 64735152
1-(4-tert-butylphenyl)-3,5-dimethylcyclohexan-1-ol (PubChem CID 64735152) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3,5-dimethylcyclohexan-1-ol.
| Compound Name | 1-(4-tert-butylphenyl)-3,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 64735152 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3,5-dimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)CC(O)(c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C18H28O/c1-13-10-14(2)12-18(19,11-13)16-8-6-15(7-9-16)17(3,4)5/h6-9,13-14,19H,10-12H2,1-5H3 |
| InChIKey | ZADSJMYEVOINRI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |