C13H14F4O — CID 64759467
1-(3-fluorophenyl)-3-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 64759467) has the molecular formula C13H14F4O and a molecular weight of 262.25 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-(3-fluorophenyl)-3-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 64759467 |
| Molecular Formula | C13H14F4O |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC1(c2cccc(F)c2)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H14F4O/c14-11-5-1-3-9(7-11)12(18)6-2-4-10(8-12)13(15,16)17/h1,3,5,7,10,18H,2,4,6,8H2 |
| InChIKey | ZRAFRZPCVIPJMK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |