C13H13Cl2F3O — CID 64757033
1-(2,3-dichlorophenyl)-3-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 64757033) has the molecular formula C13H13Cl2F3O and a molecular weight of 313.15 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 64757033 |
| Molecular Formula | C13H13Cl2F3O |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC1(c2cccc(Cl)c2Cl)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H13Cl2F3O/c14-10-5-1-4-9(11(10)15)12(19)6-2-3-8(7-12)13(16,17)18/h1,4-5,8,19H,2-3,6-7H2 |
| InChIKey | YFBZYYNWYLZIKA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |