C15H14F4O2 — CID 114723916
1-(7-fluoro-1-benzofuran-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 114723916) has the molecular formula C15H14F4O2 and a molecular weight of 302.27 g/mol. Its IUPAC name is 1-(7-fluoro-1-benzofuran-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-(7-fluoro-1-benzofuran-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 114723916 |
| Molecular Formula | C15H14F4O2 |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-(7-fluoro-1-benzofuran-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC1(c2cc3cccc(F)c3o2)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H14F4O2/c16-11-5-1-3-9-7-12(21-13(9)11)14(20)6-2-4-10(8-14)15(17,18)19/h1,3,5,7,10,20H,2,4,6,8H2 |
| InChIKey | JSLMHPWRBHVGEL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |