C16H17FO4 — CID 114724054
8-(7-fluoro-1-benzofuran-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 114724054) has the molecular formula C16H17FO4 and a molecular weight of 292.31 g/mol. Its IUPAC name is 8-(7-fluoro-1-benzofuran-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol.
| Compound Name | 8-(7-fluoro-1-benzofuran-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 114724054 |
| Molecular Formula | C16H17FO4 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 8-(7-fluoro-1-benzofuran-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | OC1(c2cc3cccc(F)c3o2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C16H17FO4/c17-12-3-1-2-11-10-13(21-14(11)12)15(18)4-6-16(7-5-15)19-8-9-20-16/h1-3,10,18H,4-9H2 |
| InChIKey | UEESJOVNXPUVBS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |