C16H19FO3 — CID 114723797
4-(7-fluoro-1-benzofuran-2-yl)-2-propyloxan-4-ol (PubChem CID 114723797) has the molecular formula C16H19FO3 and a molecular weight of 278.32 g/mol. Its IUPAC name is 4-(7-fluoro-1-benzofuran-2-yl)-2-propyloxan-4-ol.
| Compound Name | 4-(7-fluoro-1-benzofuran-2-yl)-2-propyloxan-4-ol |
|---|---|
| PubChem CID | 114723797 |
| Molecular Formula | C16H19FO3 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-(7-fluoro-1-benzofuran-2-yl)-2-propyloxan-4-ol |
| SMILES | CCCC1CC(O)(c2cc3cccc(F)c3o2)CCO1 |
| InChI | InChI=1S/C16H19FO3/c1-2-4-12-10-16(18,7-8-19-12)14-9-11-5-3-6-13(17)15(11)20-14/h3,5-6,9,12,18H,2,4,7-8,10H2,1H3 |
| InChIKey | ASQOCNAATKCZGC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |