C16H17F3O2 — CID 114723920
1-(5-methyl-1-benzofuran-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 114723920) has the molecular formula C16H17F3O2 and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-(5-methyl-1-benzofuran-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-(5-methyl-1-benzofuran-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 114723920 |
| Molecular Formula | C16H17F3O2 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-(5-methyl-1-benzofuran-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | Cc1ccc2oc(C3(O)CCCC(C(F)(F)F)C3)cc2c1 |
| InChI | InChI=1S/C16H17F3O2/c1-10-4-5-13-11(7-10)8-14(21-13)15(20)6-2-3-12(9-15)16(17,18)19/h4-5,7-8,12,20H,2-3,6,9H2,1H3 |
| InChIKey | DFQCILCGSMLXTI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |