C17H21FO2 — CID 114723986
4-ethyl-1-(5-fluoro-1-benzofuran-2-yl)cycloheptan-1-ol (PubChem CID 114723986) has the molecular formula C17H21FO2 and a molecular weight of 276.35 g/mol. Its IUPAC name is 4-ethyl-1-(5-fluoro-1-benzofuran-2-yl)cycloheptan-1-ol.
| Compound Name | 4-ethyl-1-(5-fluoro-1-benzofuran-2-yl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 114723986 |
| Molecular Formula | C17H21FO2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-ethyl-1-(5-fluoro-1-benzofuran-2-yl)cycloheptan-1-ol |
| SMILES | CCC1CCCC(O)(c2cc3cc(F)ccc3o2)CC1 |
| InChI | InChI=1S/C17H21FO2/c1-2-12-4-3-8-17(19,9-7-12)16-11-13-10-14(18)5-6-15(13)20-16/h5-6,10-12,19H,2-4,7-9H2,1H3 |
| InChIKey | ZHAQLBRTJQPDNR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |