C17H21ClO2 — CID 114723992
1-(5-chloro-1-benzofuran-2-yl)-4,4-dimethylcycloheptan-1-ol (PubChem CID 114723992) has the molecular formula C17H21ClO2 and a molecular weight of 292.81 g/mol. Its IUPAC name is 1-(5-chloro-1-benzofuran-2-yl)-4,4-dimethylcycloheptan-1-ol.
| Compound Name | 1-(5-chloro-1-benzofuran-2-yl)-4,4-dimethylcycloheptan-1-ol |
|---|---|
| PubChem CID | 114723992 |
| Molecular Formula | C17H21ClO2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-(5-chloro-1-benzofuran-2-yl)-4,4-dimethylcycloheptan-1-ol |
| SMILES | CC1(C)CCCC(O)(c2cc3cc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C17H21ClO2/c1-16(2)6-3-7-17(19,9-8-16)15-11-12-10-13(18)4-5-14(12)20-15/h4-5,10-11,19H,3,6-9H2,1-2H3 |
| InChIKey | YWEHDSMSQYRBPX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |