C15H20F2O — CID 65086098
1-(3,4-difluorophenyl)-4,4-dimethylcycloheptan-1-ol (PubChem CID 65086098) has the molecular formula C15H20F2O and a molecular weight of 254.32 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4,4-dimethylcycloheptan-1-ol.
| Compound Name | 1-(3,4-difluorophenyl)-4,4-dimethylcycloheptan-1-ol |
|---|---|
| PubChem CID | 65086098 |
| Molecular Formula | C15H20F2O |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4,4-dimethylcycloheptan-1-ol |
| SMILES | CC1(C)CCCC(O)(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H20F2O/c1-14(2)6-3-7-15(18,9-8-14)11-4-5-12(16)13(17)10-11/h4-5,10,18H,3,6-9H2,1-2H3 |
| InChIKey | BMTUNTGCYDSMGC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |