C13H20OS — CID 65099568
4,4-dimethyl-1-thiophen-3-ylcycloheptan-1-ol (PubChem CID 65099568) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is 4,4-dimethyl-1-thiophen-3-ylcycloheptan-1-ol.
| Compound Name | 4,4-dimethyl-1-thiophen-3-ylcycloheptan-1-ol |
|---|---|
| PubChem CID | 65099568 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 4,4-dimethyl-1-thiophen-3-ylcycloheptan-1-ol |
| SMILES | CC1(C)CCCC(O)(c2ccsc2)CC1 |
| InChI | InChI=1S/C13H20OS/c1-12(2)5-3-6-13(14,8-7-12)11-4-9-15-10-11/h4,9-10,14H,3,5-8H2,1-2H3 |
| InChIKey | NTNXPDHZTTWCQB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |