C16H20O3 — CID 106874108
3-methoxy-1-(5-methyl-1-benzofuran-2-yl)cyclohexan-1-ol (PubChem CID 106874108) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-methoxy-1-(5-methyl-1-benzofuran-2-yl)cyclohexan-1-ol.
| Compound Name | 3-methoxy-1-(5-methyl-1-benzofuran-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 106874108 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-methoxy-1-(5-methyl-1-benzofuran-2-yl)cyclohexan-1-ol |
| SMILES | COC1CCCC(O)(c2cc3cc(C)ccc3o2)C1 |
| InChI | InChI=1S/C16H20O3/c1-11-5-6-14-12(8-11)9-15(19-14)16(17)7-3-4-13(10-16)18-2/h5-6,8-9,13,17H,3-4,7,10H2,1-2H3 |
| InChIKey | UQXRMLMLFIAZTJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |