C16H23FO — CID 107128079
4-ethyl-1-(3-fluoro-4-methylphenyl)cycloheptan-1-ol (PubChem CID 107128079) has the molecular formula C16H23FO and a molecular weight of 250.36 g/mol. Its IUPAC name is 4-ethyl-1-(3-fluoro-4-methylphenyl)cycloheptan-1-ol.
| Compound Name | 4-ethyl-1-(3-fluoro-4-methylphenyl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 107128079 |
| Molecular Formula | C16H23FO |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-ethyl-1-(3-fluoro-4-methylphenyl)cycloheptan-1-ol |
| SMILES | CCC1CCCC(O)(c2ccc(C)c(F)c2)CC1 |
| InChI | InChI=1S/C16H23FO/c1-3-13-5-4-9-16(18,10-8-13)14-7-6-12(2)15(17)11-14/h6-7,11,13,18H,3-5,8-10H2,1-2H3 |
| InChIKey | FSBNUIFNKOBQHU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |