C15H21FO — CID 107128067
1-(3-fluoro-4-methylphenyl)-2,3-dimethylcyclohexan-1-ol (PubChem CID 107128067) has the molecular formula C15H21FO and a molecular weight of 236.33 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-2,3-dimethylcyclohexan-1-ol.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-2,3-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 107128067 |
| Molecular Formula | C15H21FO |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-2,3-dimethylcyclohexan-1-ol |
| SMILES | Cc1ccc(C2(O)CCCC(C)C2C)cc1F |
| InChI | InChI=1S/C15H21FO/c1-10-5-4-8-15(17,12(10)3)13-7-6-11(2)14(16)9-13/h6-7,9-10,12,17H,4-5,8H2,1-3H3 |
| InChIKey | VLFPCSCBKKZVCE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |