C13H16F3NO — CID 139444270
cis-(1R,3R)-3-amino-1-[3-(trifluoromethyl)phenyl]cyclohexan-1-ol (PubChem CID 139444270) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is cis-(1R,3R)-3-amino-1-[3-(trifluoromethyl)phenyl]cyclohexan-1-ol.
| Compound Name | cis-(1R,3R)-3-amino-1-[3-(trifluoromethyl)phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 139444270 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | cis-(1R,3R)-3-amino-1-[3-(trifluoromethyl)phenyl]cyclohexan-1-ol |
| SMILES | N[C@@H]1CCC[C@](O)(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H16F3NO/c14-13(15,16)10-4-1-3-9(7-10)12(18)6-2-5-11(17)8-12/h1,3-4,7,11,18H,2,5-6,8,17H2/t11-,12-/m1/s1 |
| InChIKey | NLOSPJQMNAFRMQ-VXGBXAGGSA-N |
| XLogP | 2.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |