C14H15F3OS — CID 171955702
3-[3-(trifluoromethyl)phenyl]-8-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171955702) has the molecular formula C14H15F3OS and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]-8-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]-8-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171955702 |
| Molecular Formula | C14H15F3OS |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]-8-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(c2cccc(C(F)(F)F)c2)CC2CCC(C1)S2 |
| InChI | InChI=1S/C14H15F3OS/c15-14(16,17)10-3-1-2-9(6-10)13(18)7-11-4-5-12(8-13)19-11/h1-3,6,11-12,18H,4-5,7-8H2 |
| InChIKey | IMUZHBBMUBJUKI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |