C17H21F3OS — CID 171957266
3-[2-[3-(trifluoromethyl)phenyl]ethyl]-9-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171957266) has the molecular formula C17H21F3OS and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-[2-[3-(trifluoromethyl)phenyl]ethyl]-9-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-[2-[3-(trifluoromethyl)phenyl]ethyl]-9-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171957266 |
| Molecular Formula | C17H21F3OS |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-[2-[3-(trifluoromethyl)phenyl]ethyl]-9-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | OC1(CCc2cccc(C(F)(F)F)c2)CC2CCCC(C1)S2 |
| InChI | InChI=1S/C17H21F3OS/c18-17(19,20)13-4-1-3-12(9-13)7-8-16(21)10-14-5-2-6-15(11-16)22-14/h1,3-4,9,14-15,21H,2,5-8,10-11H2 |
| InChIKey | HRGNYWXHDLTXRF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |