C17H23F3N2 — CID 138739814
4-cyclobutyl-2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 138739814) has the molecular formula C17H23F3N2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 4-cyclobutyl-2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 4-cyclobutyl-2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 138739814 |
| Molecular Formula | C17H23F3N2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 4-cyclobutyl-2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | CC1CN(C2CCC2)CCN1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N2/c1-13-11-22(16-6-3-7-16)9-8-21(13)12-14-4-2-5-15(10-14)17(18,19)20/h2,4-5,10,13,16H,3,6-9,11-12H2,1H3 |
| InChIKey | ODGDRSFJDXCLRM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |