C21H27F3N2O — CID 26349599
(4aR,8aS)-6-cyclopentyl-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 26349599) has the molecular formula C21H27F3N2O and a molecular weight of 380.45 g/mol. Its IUPAC name is (4aR,8aS)-6-cyclopentyl-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-cyclopentyl-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 26349599 |
| Molecular Formula | C21H27F3N2O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (4aR,8aS)-6-cyclopentyl-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@@H]2CN(C3CCCC3)CC[C@@H]2N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H27F3N2O/c22-21(23,24)17-5-3-4-15(12-17)13-26-19-10-11-25(18-6-1-2-7-18)14-16(19)8-9-20(26)27/h3-5,12,16,18-19H,1-2,6-11,13-14H2/t16-,19+/m1/s1 |
| InChIKey | YSTTWQYIFXKALG-APWZRJJASA-N |
| XLogP | 4.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |