C25H27F3N2O3 — CID 133123584
methyl 4-[[(4aS,8aR)-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]benzoate (PubChem CID 133123584) has the molecular formula C25H27F3N2O3 and a molecular weight of 460.50 g/mol. Its IUPAC name is methyl 4-[[(4aS,8aR)-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(4aS,8aR)-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]benzoate |
|---|---|
| PubChem CID | 133123584 |
| Molecular Formula | C25H27F3N2O3 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | methyl 4-[[(4aS,8aR)-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CC[C@@H]3[C@@H](CCC(=O)N3Cc3cccc(C(F)(F)F)c3)C2)cc1 |
| InChI | InChI=1S/C25H27F3N2O3/c1-33-24(32)19-7-5-17(6-8-19)14-29-12-11-22-20(16-29)9-10-23(31)30(22)15-18-3-2-4-21(13-18)25(26,27)28/h2-8,13,20,22H,9-12,14-16H2,1H3/t20-,22+/m0/s1 |
| InChIKey | FHAPJGUZXGZTLU-RBBKRZOGSA-N |
| XLogP | 4.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |