C30H31F3N2O2 — CID 26353029
(4aR,8aS)-6-[(4-phenylmethoxyphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 26353029) has the molecular formula C30H31F3N2O2 and a molecular weight of 508.58 g/mol. Its IUPAC name is (4aR,8aS)-6-[(4-phenylmethoxyphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-[(4-phenylmethoxyphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 26353029 |
| Molecular Formula | C30H31F3N2O2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | (4aR,8aS)-6-[(4-phenylmethoxyphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@@H]2CN(Cc3ccc(OCc4ccccc4)cc3)CC[C@@H]2N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H31F3N2O2/c31-30(32,33)26-8-4-7-24(17-26)19-35-28-15-16-34(20-25(28)11-14-29(35)36)18-22-9-12-27(13-10-22)37-21-23-5-2-1-3-6-23/h1-10,12-13,17,25,28H,11,14-16,18-21H2/t25-,28+/m1/s1 |
| InChIKey | YXGPSCYFUZQEFC-NAKRPHOHSA-N |
| XLogP | 6.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |