C25H29F3N2O3 — CID 133130200
(4aS,8aR)-6-[(2,4-dimethoxyphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 133130200) has the molecular formula C25H29F3N2O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is (4aS,8aR)-6-[(2,4-dimethoxyphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-[(2,4-dimethoxyphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 133130200 |
| Molecular Formula | C25H29F3N2O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | (4aS,8aR)-6-[(2,4-dimethoxyphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COc1ccc(CN2CC[C@@H]3[C@@H](CCC(=O)N3Cc3cccc(C(F)(F)F)c3)C2)c(OC)c1 |
| InChI | InChI=1S/C25H29F3N2O3/c1-32-21-8-6-19(23(13-21)33-2)16-29-11-10-22-18(15-29)7-9-24(31)30(22)14-17-4-3-5-20(12-17)25(26,27)28/h3-6,8,12-13,18,22H,7,9-11,14-16H2,1-2H3/t18-,22+/m0/s1 |
| InChIKey | APTAOSPBOZKDQR-PGRDOPGGSA-N |
| XLogP | 4.74 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |