C19H28N2O3 — CID 110123078
(5aS,9aR)-7-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one (PubChem CID 110123078) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (5aS,9aR)-7-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one.
| Compound Name | (5aS,9aR)-7-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
|---|---|
| PubChem CID | 110123078 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (5aS,9aR)-7-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
| SMILES | COc1ccc(CN2CC[C@@H]3[C@@H](CCCC(=O)N3C)C2)c(OC)c1 |
| InChI | InChI=1S/C19H28N2O3/c1-20-17-9-10-21(12-14(17)5-4-6-19(20)22)13-15-7-8-16(23-2)11-18(15)24-3/h7-8,11,14,17H,4-6,9-10,12-13H2,1-3H3/t14-,17+/m0/s1 |
| InChIKey | LFRWHAPYEUVUDK-WMLDXEAASA-N |
| XLogP | 2.54 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |