C19H28N2O3 — CID 26275442
(4aR,8aS)-1-(2-methoxyethyl)-6-[(2-methoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 26275442) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (4aR,8aS)-1-(2-methoxyethyl)-6-[(2-methoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-(2-methoxyethyl)-6-[(2-methoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 26275442 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (4aR,8aS)-1-(2-methoxyethyl)-6-[(2-methoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COCCN1C(=O)CC[C@@H]2CN(Cc3ccccc3OC)CC[C@@H]21 |
| InChI | InChI=1S/C19H28N2O3/c1-23-12-11-21-17-9-10-20(13-15(17)7-8-19(21)22)14-16-5-3-4-6-18(16)24-2/h3-6,15,17H,7-14H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | RGWZLFROWYNXII-WBVHZDCISA-N |
| XLogP | 2.15 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |