C19H28FN3O2 — CID 56905158
(4aS,8aR)-6-[(5-fluoro-2-methoxyphenyl)methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56905158) has the molecular formula C19H28FN3O2 and a molecular weight of 349.45 g/mol. Its IUPAC name is (4aS,8aR)-6-[(5-fluoro-2-methoxyphenyl)methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-[(5-fluoro-2-methoxyphenyl)methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56905158 |
| Molecular Formula | C19H28FN3O2 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (4aS,8aR)-6-[(5-fluoro-2-methoxyphenyl)methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(Cc3cc(F)ccc3OC)CC[C@H]21 |
| InChI | InChI=1S/C19H28FN3O2/c1-21-8-10-23-17-7-9-22(12-14(17)3-6-19(23)24)13-15-11-16(20)4-5-18(15)25-2/h4-5,11,14,17,21H,3,6-10,12-13H2,1-2H3/t14-,17+/m0/s1 |
| InChIKey | FTTHEFUMDKFSIE-WMLDXEAASA-N |
| XLogP | 1.87 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |