C18H29N5O2 — CID 56915718
(4aS,8aR)-6-[[2-(methoxymethyl)pyrimidin-5-yl]methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56915718) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (4aS,8aR)-6-[[2-(methoxymethyl)pyrimidin-5-yl]methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-[[2-(methoxymethyl)pyrimidin-5-yl]methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56915718 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (4aS,8aR)-6-[[2-(methoxymethyl)pyrimidin-5-yl]methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(Cc3cnc(COC)nc3)CC[C@H]21 |
| InChI | InChI=1S/C18H29N5O2/c1-19-6-8-23-16-5-7-22(12-15(16)3-4-18(23)24)11-14-9-20-17(13-25-2)21-10-14/h9-10,15-16,19H,3-8,11-13H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | BGUHLRHOKUXHSX-JKSUJKDBSA-N |
| XLogP | 0.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |