C18H30N4OS — CID 56887017
(4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56887017) has the molecular formula C18H30N4OS and a molecular weight of 350.53 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56887017 |
| Molecular Formula | C18H30N4OS |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(Cc3nc(C(C)C)cs3)CC[C@H]21 |
| InChI | InChI=1S/C18H30N4OS/c1-13(2)15-12-24-17(20-15)11-21-8-6-16-14(10-21)4-5-18(23)22(16)9-7-19-3/h12-14,16,19H,4-11H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | AIHFRTNAQZQOMY-GOEBONIOSA-N |
| XLogP | 2.30 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |