C20H27N3O2 — CID 56897464
2-[[(4aS,8aR)-1-(3-methoxypropyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]benzonitrile (PubChem CID 56897464) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[[(4aS,8aR)-1-(3-methoxypropyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]benzonitrile.
| Compound Name | 2-[[(4aS,8aR)-1-(3-methoxypropyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 56897464 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-[[(4aS,8aR)-1-(3-methoxypropyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]benzonitrile |
| SMILES | COCCCN1C(=O)CC[C@H]2CN(Cc3ccccc3C#N)CC[C@H]21 |
| InChI | InChI=1S/C20H27N3O2/c1-25-12-4-10-23-19-9-11-22(15-18(19)7-8-20(23)24)14-17-6-3-2-5-16(17)13-21/h2-3,5-6,18-19H,4,7-12,14-15H2,1H3/t18-,19+/m0/s1 |
| InChIKey | UNWGVAUYJOZZDM-RBUKOAKNSA-N |
| XLogP | 2.41 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|