C13H17NO2 — CID 58733507
1-[(2-methoxyphenyl)methyl]-5-methylpyrrolidin-2-one (PubChem CID 58733507) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-5-methylpyrrolidin-2-one.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 58733507 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-5-methylpyrrolidin-2-one |
| SMILES | COc1ccccc1CN1C(=O)CCC1C |
| InChI | InChI=1S/C13H17NO2/c1-10-7-8-13(15)14(10)9-11-5-3-4-6-12(11)16-2/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | SQYGUNVVNPJJCB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |