C25H27N3O3 — CID 91955924
N-[3-(2,5-dimethylpyrrol-1-yl)phenyl]-1-[(2-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 91955924) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[3-(2,5-dimethylpyrrol-1-yl)phenyl]-1-[(2-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-[3-(2,5-dimethylpyrrol-1-yl)phenyl]-1-[(2-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91955924 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[3-(2,5-dimethylpyrrol-1-yl)phenyl]-1-[(2-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | COc1ccccc1CN1C(=O)CCC1C(=O)Nc1cccc(-n2c(C)ccc2C)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-17-11-12-18(2)28(17)21-9-6-8-20(15-21)26-25(30)22-13-14-24(29)27(22)16-19-7-4-5-10-23(19)31-3/h4-12,15,22H,13-14,16H2,1-3H3,(H,26,30) |
| InChIKey | UKMDCKQUUVEAMN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|