C17H21NO4 — CID 124567118
(3aS,7aS)-1-[(2,4-dimethoxyphenyl)methyl]-3,3a,4,5,7,7a-hexahydroindole-2,6-dione (PubChem CID 124567118) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (3aS,7aS)-1-[(2,4-dimethoxyphenyl)methyl]-3,3a,4,5,7,7a-hexahydroindole-2,6-dione.
| Compound Name | (3aS,7aS)-1-[(2,4-dimethoxyphenyl)methyl]-3,3a,4,5,7,7a-hexahydroindole-2,6-dione |
|---|---|
| PubChem CID | 124567118 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (3aS,7aS)-1-[(2,4-dimethoxyphenyl)methyl]-3,3a,4,5,7,7a-hexahydroindole-2,6-dione |
| SMILES | COc1ccc(CN2C(=O)C[C@@H]3CCC(=O)C[C@@H]32)c(OC)c1 |
| InChI | InChI=1S/C17H21NO4/c1-21-14-6-4-12(16(9-14)22-2)10-18-15-8-13(19)5-3-11(15)7-17(18)20/h4,6,9,11,15H,3,5,7-8,10H2,1-2H3/t11-,15-/m0/s1 |
| InChIKey | QEQBICVQAHCCEY-NHYWBVRUSA-N |
| XLogP | 2.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |