C18H19NO3S — CID 3364684
3-[(2,4-dimethoxyphenyl)methyl]-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 3364684) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 3-[(2,4-dimethoxyphenyl)methyl]-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 3-[(2,4-dimethoxyphenyl)methyl]-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3364684 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-[(2,4-dimethoxyphenyl)methyl]-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CN2C(=O)CSC2c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C18H19NO3S/c1-21-15-9-8-14(16(10-15)22-2)11-19-17(20)12-23-18(19)13-6-4-3-5-7-13/h3-10,18H,11-12H2,1-2H3 |
| InChIKey | HVSSSBBJMFRXQF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |