C18H20N2O3 — CID 131864147
(3S,4R)-3-amino-1-[(2,4-dimethoxyphenyl)methyl]-4-phenylazetidin-2-one (PubChem CID 131864147) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3S,4R)-3-amino-1-[(2,4-dimethoxyphenyl)methyl]-4-phenylazetidin-2-one.
| Compound Name | (3S,4R)-3-amino-1-[(2,4-dimethoxyphenyl)methyl]-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 131864147 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (3S,4R)-3-amino-1-[(2,4-dimethoxyphenyl)methyl]-4-phenylazetidin-2-one |
| SMILES | COc1ccc(CN2C(=O)[C@@H](N)[C@H]2c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-22-14-9-8-13(15(10-14)23-2)11-20-17(16(19)18(20)21)12-6-4-3-5-7-12/h3-10,16-17H,11,19H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | UWBVGJKLBGUYGO-DLBZAZTESA-N |
| XLogP | 2.11 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |